C10H13N5O2 — CID 168600995
methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoate (PubChem CID 168600995) has the molecular formula C10H13N5O2 and a molecular weight of 235.25 g/mol. Its IUPAC name is methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoate.
| Compound Name | methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoate |
|---|---|
| PubChem CID | 168600995 |
| Molecular Formula | C10H13N5O2 |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | methyl 4-[[amino-(diaminomethylideneamino)methylidene]amino]benzoate |
| SMILES | COC(=O)c1ccc(/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C10H13N5O2/c1-17-8(16)6-2-4-7(5-3-6)14-10(13)15-9(11)12/h2-5H,1H3,(H6,11,12,13,14,15) |
| InChIKey | YUGFSBMOWVLKGS-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|