C10H14N6O2 — CID 168605433
methyl N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]carbamate (PubChem CID 168605433) has the molecular formula C10H14N6O2 and a molecular weight of 250.26 g/mol. Its IUPAC name is methyl N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]carbamate.
| Compound Name | methyl N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]carbamate |
|---|---|
| PubChem CID | 168605433 |
| Molecular Formula | C10H14N6O2 |
| Molecular Weight | 250.26 g/mol |
| Exact Mass | 250.12 |
| IUPAC Name | methyl N-[4-[[amino-(diaminomethylideneamino)methylidene]amino]phenyl]carbamate |
| SMILES | COC(=O)Nc1ccc(/N=C(\N)N=C(N)N)cc1 |
| InChI | InChI=1S/C10H14N6O2/c1-18-10(17)15-7-4-2-6(3-5-7)14-9(13)16-8(11)12/h2-5H,1H3,(H,15,17)(H6,11,12,13,14,16) |
| InChIKey | JMJUOQYSPBGIGA-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 141.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|