C16H17ClN6O — CID 54149924
N-[4-[[N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidoyl]amino]phenyl]acetamide (PubChem CID 54149924) has the molecular formula C16H17ClN6O and a molecular weight of 344.81 g/mol. Its IUPAC name is N-[4-[[N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidoyl]amino]phenyl]acetamide.
| Compound Name | N-[4-[[N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidoyl]amino]phenyl]acetamide |
|---|---|
| PubChem CID | 54149924 |
| Molecular Formula | C16H17ClN6O |
| Molecular Weight | 344.81 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | N-[4-[[N'-[N'-(4-chlorophenyl)carbamimidoyl]carbamimidoyl]amino]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(NC(N)=N/C(N)=N/c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C16H17ClN6O/c1-10(24)20-12-6-8-14(9-7-12)22-16(19)23-15(18)21-13-4-2-11(17)3-5-13/h2-9H,1H3,(H,20,24)(H5,18,19,21,22,23) |
| InChIKey | OHAQSRWWWRWRPQ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 117.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.81 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|