C14H15N5O3S — CID 154313965
4-[[amino-[[amino(anilino)methylidene]amino]methylidene]amino]benzenesulfonic acid (PubChem CID 154313965) has the molecular formula C14H15N5O3S and a molecular weight of 333.37 g/mol. Its IUPAC name is 4-[[amino-[[amino(anilino)methylidene]amino]methylidene]amino]benzenesulfonic acid.
| Compound Name | 4-[[amino-[[amino(anilino)methylidene]amino]methylidene]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 154313965 |
| Molecular Formula | C14H15N5O3S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.09 |
| IUPAC Name | 4-[[amino-[[amino(anilino)methylidene]amino]methylidene]amino]benzenesulfonic acid |
| SMILES | NC(=N/C(N)=N/c1ccc(S(=O)(=O)O)cc1)Nc1ccccc1 |
| InChI | InChI=1S/C14H15N5O3S/c15-13(17-10-4-2-1-3-5-10)19-14(16)18-11-6-8-12(9-7-11)23(20,21)22/h1-9H,(H,20,21,22)(H5,15,16,17,18,19) |
| InChIKey | RVDXNPFLLIMPLU-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 143.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|