C13H20N6O2S — CID 14981776
(1E)-1-[amino(anilino)methylidene]-2-piperidin-1-ylsulfonylguanidine (PubChem CID 14981776) has the molecular formula C13H20N6O2S and a molecular weight of 324.41 g/mol. Its IUPAC name is (1E)-1-[amino(anilino)methylidene]-2-piperidin-1-ylsulfonylguanidine.
| Compound Name | (1E)-1-[amino(anilino)methylidene]-2-piperidin-1-ylsulfonylguanidine |
|---|---|
| PubChem CID | 14981776 |
| Molecular Formula | C13H20N6O2S |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | (1E)-1-[amino(anilino)methylidene]-2-piperidin-1-ylsulfonylguanidine |
| SMILES | NC(=N\S(=O)(=O)N1CCCCC1)/N=C(\N)Nc1ccccc1 |
| InChI | InChI=1S/C13H20N6O2S/c14-12(16-11-7-3-1-4-8-11)17-13(15)18-22(20,21)19-9-5-2-6-10-19/h1,3-4,7-8H,2,5-6,9-10H2,(H5,14,15,16,17,18) |
| InChIKey | VQXNVVMIDRAWGD-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 126.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|