C19H25IN4O2S — CID 110927853
1-phenyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 110927853) has the molecular formula C19H25IN4O2S and a molecular weight of 500.41 g/mol. Its IUPAC name is 1-phenyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-phenyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110927853 |
| Molecular Formula | C19H25IN4O2S |
| Molecular Weight | 500.41 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | 1-phenyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(S(=O)(=O)N2CCCCC2)c1)Nc1ccccc1 |
| InChI | InChI=1S/C19H24N4O2S.HI/c20-19(22-17-9-3-1-4-10-17)21-15-16-8-7-11-18(14-16)26(24,25)23-12-5-2-6-13-23;/h1,3-4,7-11,14H,2,5-6,12-13,15H2,(H3,20,21,22);1H |
| InChIKey | CEFXLCLOFUAWFW-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.41 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|