C20H27IN4O2S — CID 111072462
1-(3-ethylphenyl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111072462) has the molecular formula C20H27IN4O2S and a molecular weight of 514.43 g/mol. Its IUPAC name is 1-(3-ethylphenyl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylphenyl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111072462 |
| Molecular Formula | C20H27IN4O2S |
| Molecular Weight | 514.43 g/mol |
| Exact Mass | 514.09 |
| IUPAC Name | 1-(3-ethylphenyl)-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCc1cccc(N/C(N)=N/Cc2ccc(S(=O)(=O)N3CCCC3)cc2)c1.I |
| InChI | InChI=1S/C20H26N4O2S.HI/c1-2-16-6-5-7-18(14-16)23-20(21)22-15-17-8-10-19(11-9-17)27(25,26)24-12-3-4-13-24;/h5-11,14H,2-4,12-13,15H2,1H3,(H3,21,22,23);1H |
| InChIKey | IUNNJGCEYBYXIZ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.43 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|