C22H29IN4O3S — CID 111600047
1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111600047) has the molecular formula C22H29IN4O3S and a molecular weight of 556.47 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111600047 |
| Molecular Formula | C22H29IN4O3S |
| Molecular Weight | 556.47 g/mol |
| Exact Mass | 556.10 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(S(=O)(=O)N2CCCCC2)c1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C22H28N4O3S.HI/c23-22(25-20-11-14-29-21-10-3-2-9-19(20)21)24-16-17-7-6-8-18(15-17)30(27,28)26-12-4-1-5-13-26;/h2-3,6-10,15,20H,1,4-5,11-14,16H2,(H3,23,24,25);1H |
| InChIKey | WNFSAOGPRPJOBQ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|