C25H26IN3O3 — CID 111600213
benzyl 3-[[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]methyl]benzoate;hydroiodide (PubChem CID 111600213) has the molecular formula C25H26IN3O3 and a molecular weight of 543.41 g/mol. Its IUPAC name is benzyl 3-[[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]methyl]benzoate;hydroiodide.
| Compound Name | benzyl 3-[[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]methyl]benzoate;hydroiodide |
|---|---|
| PubChem CID | 111600213 |
| Molecular Formula | C25H26IN3O3 |
| Molecular Weight | 543.41 g/mol |
| Exact Mass | 543.10 |
| IUPAC Name | benzyl 3-[[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]methyl]benzoate;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(C(=O)OCc2ccccc2)c1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C25H25N3O3.HI/c26-25(28-22-13-14-30-23-12-5-4-11-21(22)23)27-16-19-9-6-10-20(15-19)24(29)31-17-18-7-2-1-3-8-18;/h1-12,15,22H,13-14,16-17H2,(H3,26,27,28);1H |
| InChIKey | NRBFVKAAXQBTPO-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 85.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|