C19H22N4O2 — CID 119141008
3-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]benzamide (PubChem CID 119141008) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 3-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]benzamide.
| Compound Name | 3-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]benzamide |
|---|---|
| PubChem CID | 119141008 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 3-[2-[[amino-(3,4-dihydro-2H-chromen-4-ylamino)methylidene]amino]ethyl]benzamide |
| SMILES | NC(=O)c1cccc(CC/N=C(\N)NC2CCOc3ccccc32)c1 |
| InChI | InChI=1S/C19H22N4O2/c20-18(24)14-5-3-4-13(12-14)8-10-22-19(21)23-16-9-11-25-17-7-2-1-6-15(16)17/h1-7,12,16H,8-11H2,(H2,20,24)(H3,21,22,23) |
| InChIKey | OBKLONPQKJDFQO-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 102.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|