C17H26IN3O2 — CID 110018676
1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 110018676) has the molecular formula C17H26IN3O2 and a molecular weight of 431.32 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110018676 |
| Molecular Formula | C17H26IN3O2 |
| Molecular Weight | 431.32 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[2-(oxan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CCC1CCCCO1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C17H25N3O2.HI/c18-17(19-10-8-13-5-3-4-11-21-13)20-15-9-12-22-16-7-2-1-6-14(15)16;/h1-2,6-7,13,15H,3-5,8-12H2,(H3,18,19,20);1H |
| InChIKey | AISCXIWPNMKNCM-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|