C22H27IN4O2 — CID 111598539
1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide (PubChem CID 111598539) has the molecular formula C22H27IN4O2 and a molecular weight of 506.39 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111598539 |
| Molecular Formula | C22H27IN4O2 |
| Molecular Weight | 506.39 g/mol |
| Exact Mass | 506.12 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-4-yl)-2-[[3-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1cccc(CN2CCCC2=O)c1)NC1CCOc2ccccc21 |
| InChI | InChI=1S/C22H26N4O2.HI/c23-22(25-19-10-12-28-20-8-2-1-7-18(19)20)24-14-16-5-3-6-17(13-16)15-26-11-4-9-21(26)27;/h1-3,5-8,13,19H,4,9-12,14-15H2,(H3,23,24,25);1H |
| InChIKey | YUMPGOHWSHRMGM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 79.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.39 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|