C19H30N4O2S — CID 111094714
1-cyclohexyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111094714) has the molecular formula C19H30N4O2S and a molecular weight of 378.54 g/mol. Its IUPAC name is 1-cyclohexyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111094714 |
| Molecular Formula | C19H30N4O2S |
| Molecular Weight | 378.54 g/mol |
| Exact Mass | 378.21 |
| IUPAC Name | 1-cyclohexyl-2-[(3-piperidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1cccc(S(=O)(=O)N2CCCCC2)c1)NC1CCCCC1 |
| InChI | InChI=1S/C19H30N4O2S/c20-19(22-17-9-3-1-4-10-17)21-15-16-8-7-11-18(14-16)26(24,25)23-12-5-2-6-13-23/h7-8,11,14,17H,1-6,9-10,12-13,15H2,(H3,20,21,22) |
| InChIKey | KPGHBIPPZDCZDU-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.54 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|