C18H29IN4O2S — CID 119121072
2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-cyclopentylguanidine;hydroiodide (PubChem CID 119121072) has the molecular formula C18H29IN4O2S and a molecular weight of 492.43 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-cyclopentylguanidine;hydroiodide.
| Compound Name | 2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-cyclopentylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119121072 |
| Molecular Formula | C18H29IN4O2S |
| Molecular Weight | 492.43 g/mol |
| Exact Mass | 492.11 |
| IUPAC Name | 2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-cyclopentylguanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(S(=O)(=O)c2ccccc2)CC1)NC1CCCC1 |
| InChI | InChI=1S/C18H28N4O2S.HI/c19-18(21-16-6-4-5-7-16)20-14-15-10-12-22(13-11-15)25(23,24)17-8-2-1-3-9-17;/h1-3,8-9,15-16H,4-7,10-14H2,(H3,19,20,21);1H |
| InChIKey | SPDSRNORDNMNQR-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|