C14H25F3N4O2S — CID 111560078
1-cyclohexyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 111560078) has the molecular formula C14H25F3N4O2S and a molecular weight of 370.44 g/mol. Its IUPAC name is 1-cyclohexyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 111560078 |
| Molecular Formula | C14H25F3N4O2S |
| Molecular Weight | 370.44 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | 1-cyclohexyl-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | N/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C14H25F3N4O2S/c15-14(16,17)24(22,23)21-8-6-11(7-9-21)10-19-13(18)20-12-4-2-1-3-5-12/h11-12H,1-10H2,(H3,18,19,20) |
| InChIKey | OKBSMIRNBYNWBD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.44 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|