C14H26F2N4O2S — CID 119147709
1-cyclohexyl-2-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine (PubChem CID 119147709) has the molecular formula C14H26F2N4O2S and a molecular weight of 352.45 g/mol. Its IUPAC name is 1-cyclohexyl-2-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine.
| Compound Name | 1-cyclohexyl-2-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
|---|---|
| PubChem CID | 119147709 |
| Molecular Formula | C14H26F2N4O2S |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 1-cyclohexyl-2-[[1-(difluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine |
| SMILES | N/C(=N\CC1CCN(S(=O)(=O)C(F)F)CC1)NC1CCCCC1 |
| InChI | InChI=1S/C14H26F2N4O2S/c15-13(16)23(21,22)20-8-6-11(7-9-20)10-18-14(17)19-12-4-2-1-3-5-12/h11-13H,1-10H2,(H3,17,18,19) |
| InChIKey | NKZBNNXLLSLWRW-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|