C15H23F3IN5O2S — CID 111559727
1-(2-pyridin-2-ylethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide (PubChem CID 111559727) has the molecular formula C15H23F3IN5O2S and a molecular weight of 521.35 g/mol. Its IUPAC name is 1-(2-pyridin-2-ylethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-pyridin-2-ylethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111559727 |
| Molecular Formula | C15H23F3IN5O2S |
| Molecular Weight | 521.35 g/mol |
| Exact Mass | 521.06 |
| IUPAC Name | 1-(2-pyridin-2-ylethyl)-2-[[1-(trifluoromethylsulfonyl)piperidin-4-yl]methyl]guanidine;hydroiodide |
| SMILES | I.N/C(=N\CC1CCN(S(=O)(=O)C(F)(F)F)CC1)NCCc1ccccn1 |
| InChI | InChI=1S/C15H22F3N5O2S.HI/c16-15(17,18)26(24,25)23-9-5-12(6-10-23)11-22-14(19)21-8-4-13-3-1-2-7-20-13;/h1-3,7,12H,4-6,8-11H2,(H3,19,21,22);1H |
| InChIKey | UKCSNBIOZCWFCE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.35 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|