C20H28IN5O2S — CID 111039833
2-[(2-piperidin-1-ylsulfonylphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111039833) has the molecular formula C20H28IN5O2S and a molecular weight of 529.45 g/mol. Its IUPAC name is 2-[(2-piperidin-1-ylsulfonylphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-piperidin-1-ylsulfonylphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111039833 |
| Molecular Formula | C20H28IN5O2S |
| Molecular Weight | 529.45 g/mol |
| Exact Mass | 529.10 |
| IUPAC Name | 2-[(2-piperidin-1-ylsulfonylphenyl)methyl]-1-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | I.N/C(=N\Cc1ccccc1S(=O)(=O)N1CCCCC1)NCCc1ccccn1 |
| InChI | InChI=1S/C20H27N5O2S.HI/c21-20(23-13-11-18-9-4-5-12-22-18)24-16-17-8-2-3-10-19(17)28(26,27)25-14-6-1-7-15-25;/h2-5,8-10,12H,1,6-7,11,13-16H2,(H3,21,23,24);1H |
| InChIKey | HHGVACWFBUFPCY-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 100.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|