C20H25N5O — CID 111052629
2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine (PubChem CID 111052629) has the molecular formula C20H25N5O and a molecular weight of 351.45 g/mol. Its IUPAC name is 2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine.
| Compound Name | 2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111052629 |
| Molecular Formula | C20H25N5O |
| Molecular Weight | 351.45 g/mol |
| Exact Mass | 351.21 |
| IUPAC Name | 2-[[2-[(2-oxopyrrolidin-1-yl)methyl]phenyl]methyl]-1-(2-pyridin-2-ylethyl)guanidine |
| SMILES | N/C(=N\Cc1ccccc1CN1CCCC1=O)NCCc1ccccn1 |
| InChI | InChI=1S/C20H25N5O/c21-20(23-12-10-18-8-3-4-11-22-18)24-14-16-6-1-2-7-17(16)15-25-13-5-9-19(25)26/h1-4,6-8,11H,5,9-10,12-15H2,(H3,21,23,24) |
| InChIKey | SSOHYVFVICEANC-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.45 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|