C22H32IN5O2S — CID 111192913
1-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide (PubChem CID 111192913) has the molecular formula C22H32IN5O2S and a molecular weight of 557.50 g/mol. Its IUPAC name is 1-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111192913 |
| Molecular Formula | C22H32IN5O2S |
| Molecular Weight | 557.50 g/mol |
| Exact Mass | 557.13 |
| IUPAC Name | 1-ethyl-2-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(2-pyridin-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCCC2)cc1)NCCc1ccccn1.I |
| InChI | InChI=1S/C22H31N5O2S.HI/c1-2-23-22(25-15-13-20-8-4-5-14-24-20)26-18-19-9-11-21(12-10-19)30(28,29)27-16-6-3-7-17-27;/h4-5,8-12,14H,2-3,6-7,13,15-18H2,1H3,(H2,23,25,26);1H |
| InChIKey | AVLLVYVVALCSHQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.50 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|