C22H30FIN4O2S — CID 111362154
1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111362154) has the molecular formula C22H30FIN4O2S and a molecular weight of 560.48 g/mol. Its IUPAC name is 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111362154 |
| Molecular Formula | C22H30FIN4O2S |
| Molecular Weight | 560.48 g/mol |
| Exact Mass | 560.11 |
| IUPAC Name | 1-ethyl-3-[2-(2-fluorophenyl)ethyl]-2-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N2CCCC2)cc1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C22H29FN4O2S.HI/c1-2-24-22(25-14-13-19-7-3-4-8-21(19)23)26-17-18-9-11-20(12-10-18)30(28,29)27-15-5-6-16-27;/h3-4,7-12H,2,5-6,13-17H2,1H3,(H2,24,25,26);1H |
| InChIKey | KTFQQNOGRXXCEX-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.48 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|