C23H32FIN4O2S — CID 111361368
2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide (PubChem CID 111361368) has the molecular formula C23H32FIN4O2S and a molecular weight of 574.50 g/mol. Its IUPAC name is 2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111361368 |
| Molecular Formula | C23H32FIN4O2S |
| Molecular Weight | 574.50 g/mol |
| Exact Mass | 574.13 |
| IUPAC Name | 2-[[1-(benzenesulfonyl)piperidin-4-yl]methyl]-1-ethyl-3-[2-(2-fluorophenyl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCN(S(=O)(=O)c2ccccc2)CC1)NCCc1ccccc1F.I |
| InChI | InChI=1S/C23H31FN4O2S.HI/c1-2-25-23(26-15-12-20-8-6-7-11-22(20)24)27-18-19-13-16-28(17-14-19)31(29,30)21-9-4-3-5-10-21;/h3-11,19H,2,12-18H2,1H3,(H2,25,26,27);1H |
| InChIKey | DZVVKLWFDWVQRM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.50 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|