C17H29IN4O2S — CID 111039807
1-butyl-2-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111039807) has the molecular formula C17H29IN4O2S and a molecular weight of 480.42 g/mol. Its IUPAC name is 1-butyl-2-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111039807 |
| Molecular Formula | C17H29IN4O2S |
| Molecular Weight | 480.42 g/mol |
| Exact Mass | 480.11 |
| IUPAC Name | 1-butyl-2-[(2-piperidin-1-ylsulfonylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(N)=N/Cc1ccccc1S(=O)(=O)N1CCCCC1.I |
| InChI | InChI=1S/C17H28N4O2S.HI/c1-2-3-11-19-17(18)20-14-15-9-5-6-10-16(15)24(22,23)21-12-7-4-8-13-21;/h5-6,9-10H,2-4,7-8,11-14H2,1H3,(H3,18,19,20);1H |
| InChIKey | RMFQFPCNQRVLRI-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.42 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|