C17H29IN4O3S — CID 111064355
1-butyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111064355) has the molecular formula C17H29IN4O3S and a molecular weight of 496.42 g/mol. Its IUPAC name is 1-butyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-butyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111064355 |
| Molecular Formula | C17H29IN4O3S |
| Molecular Weight | 496.42 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 1-butyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCCCN/C(N)=N/Cc1ccccc1CS(=O)(=O)N1CCOCC1.I |
| InChI | InChI=1S/C17H28N4O3S.HI/c1-2-3-8-19-17(18)20-13-15-6-4-5-7-16(15)14-25(22,23)21-9-11-24-12-10-21;/h4-7H,2-3,8-14H2,1H3,(H3,18,19,20);1H |
| InChIKey | CHEVPOLMVZCTGC-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 97.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.42 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|