C19H33IN4O4S — CID 111897152
1-(2-ethoxyethyl)-3-ethyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111897152) has the molecular formula C19H33IN4O4S and a molecular weight of 540.47 g/mol. Its IUPAC name is 1-(2-ethoxyethyl)-3-ethyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(2-ethoxyethyl)-3-ethyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111897152 |
| Molecular Formula | C19H33IN4O4S |
| Molecular Weight | 540.47 g/mol |
| Exact Mass | 540.13 |
| IUPAC Name | 1-(2-ethoxyethyl)-3-ethyl-2-[[2-(morpholin-4-ylsulfonylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccccc1CS(=O)(=O)N1CCOCC1)NCCOCC.I |
| InChI | InChI=1S/C19H32N4O4S.HI/c1-3-20-19(21-9-12-26-4-2)22-15-17-7-5-6-8-18(17)16-28(24,25)23-10-13-27-14-11-23;/h5-8H,3-4,9-16H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | SVAFBHVUWZJFLR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.47 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|