C12H17N3O2S — CID 75092022
N'-(benzenesulfonyl)piperidine-1-carboximidamide (PubChem CID 75092022) has the molecular formula C12H17N3O2S and a molecular weight of 267.35 g/mol. Its IUPAC name is N'-(benzenesulfonyl)piperidine-1-carboximidamide.
| Compound Name | N'-(benzenesulfonyl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 75092022 |
| Molecular Formula | C12H17N3O2S |
| Molecular Weight | 267.35 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | N'-(benzenesulfonyl)piperidine-1-carboximidamide |
| SMILES | NC(=NS(=O)(=O)c1ccccc1)N1CCCCC1 |
| InChI | InChI=1S/C12H17N3O2S/c13-12(15-9-5-2-6-10-15)14-18(16,17)11-7-3-1-4-8-11/h1,3-4,7-8H,2,5-6,9-10H2,(H2,13,14) |
| InChIKey | KMMUWYBJNCAIFY-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.35 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|