C8H7Cl3N2O2S — CID 34555254
N'-(benzenesulfonyl)-2,2,2-trichloroethanimidamide (PubChem CID 34555254) has the molecular formula C8H7Cl3N2O2S and a molecular weight of 301.58 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-2,2,2-trichloroethanimidamide.
| Compound Name | N'-(benzenesulfonyl)-2,2,2-trichloroethanimidamide |
|---|---|
| PubChem CID | 34555254 |
| Molecular Formula | C8H7Cl3N2O2S |
| Molecular Weight | 301.58 g/mol |
| Exact Mass | 299.93 |
| IUPAC Name | N'-(benzenesulfonyl)-2,2,2-trichloroethanimidamide |
| SMILES | NC(=NS(=O)(=O)c1ccccc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H7Cl3N2O2S/c9-8(10,11)7(12)13-16(14,15)6-4-2-1-3-5-6/h1-5H,(H2,12,13) |
| InChIKey | WIPOZBUSLLPTSR-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|