C8H6Cl4N2O2S — CID 2974867
2,2,2-trichloro-N'-(4-chlorophenyl)sulfonylethanimidamide (PubChem CID 2974867) has the molecular formula C8H6Cl4N2O2S and a molecular weight of 336.03 g/mol. Its IUPAC name is 2,2,2-trichloro-N'-(4-chlorophenyl)sulfonylethanimidamide.
| Compound Name | 2,2,2-trichloro-N'-(4-chlorophenyl)sulfonylethanimidamide |
|---|---|
| PubChem CID | 2974867 |
| Molecular Formula | C8H6Cl4N2O2S |
| Molecular Weight | 336.03 g/mol |
| Exact Mass | 333.89 |
| IUPAC Name | 2,2,2-trichloro-N'-(4-chlorophenyl)sulfonylethanimidamide |
| SMILES | NC(=NS(=O)(=O)c1ccc(Cl)cc1)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C8H6Cl4N2O2S/c9-5-1-3-6(4-2-5)17(15,16)14-7(13)8(10,11)12/h1-4H,(H2,13,14) |
| InChIKey | KPZCYJKOLFBZBV-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.03 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|