C12H18N2O2S — CID 73166022
2,2-dimethyl-N'-(4-methylphenyl)sulfonylpropanimidamide (PubChem CID 73166022) has the molecular formula C12H18N2O2S and a molecular weight of 254.36 g/mol. Its IUPAC name is 2,2-dimethyl-N'-(4-methylphenyl)sulfonylpropanimidamide.
| Compound Name | 2,2-dimethyl-N'-(4-methylphenyl)sulfonylpropanimidamide |
|---|---|
| PubChem CID | 73166022 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.36 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 2,2-dimethyl-N'-(4-methylphenyl)sulfonylpropanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(N)C(C)(C)C)cc1 |
| InChI | InChI=1S/C12H18N2O2S/c1-9-5-7-10(8-6-9)17(15,16)14-11(13)12(2,3)4/h5-8H,1-4H3,(H2,13,14) |
| InChIKey | LBINSRGNYRSLIE-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.36 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|