C15H17N3O2S — CID 67176300
1-methyl-2-(4-methylphenyl)sulfonyl-1-phenylguanidine (PubChem CID 67176300) has the molecular formula C15H17N3O2S and a molecular weight of 303.39 g/mol. Its IUPAC name is 1-methyl-2-(4-methylphenyl)sulfonyl-1-phenylguanidine.
| Compound Name | 1-methyl-2-(4-methylphenyl)sulfonyl-1-phenylguanidine |
|---|---|
| PubChem CID | 67176300 |
| Molecular Formula | C15H17N3O2S |
| Molecular Weight | 303.39 g/mol |
| Exact Mass | 303.10 |
| IUPAC Name | 1-methyl-2-(4-methylphenyl)sulfonyl-1-phenylguanidine |
| SMILES | Cc1ccc(S(=O)(=O)N=C(N)N(C)c2ccccc2)cc1 |
| InChI | InChI=1S/C15H17N3O2S/c1-12-8-10-14(11-9-12)21(19,20)17-15(16)18(2)13-6-4-3-5-7-13/h3-11H,1-2H3,(H2,16,17) |
| InChIKey | DKYYYOJVZDJNPE-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.39 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|