C22H21N3O2S — CID 2303263
4-methyl-N'-[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]benzenecarboximidamide (PubChem CID 2303263) has the molecular formula C22H21N3O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 4-methyl-N'-[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]benzenecarboximidamide.
| Compound Name | 4-methyl-N'-[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]benzenecarboximidamide |
|---|---|
| PubChem CID | 2303263 |
| Molecular Formula | C22H21N3O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 4-methyl-N'-[N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]benzenecarboximidamide |
| SMILES | Cc1ccc(/C(N)=N/C(=NS(=O)(=O)c2ccc(C)cc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H21N3O2S/c1-16-8-12-18(13-9-16)21(23)24-22(19-6-4-3-5-7-19)25-28(26,27)20-14-10-17(2)11-15-20/h3-15H,1-2H3,(H2,23,24,25) |
| InChIKey | PYXCGSDKHDYVCK-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|