C34H28N4O4S2 — CID 75408906
N'-(4-methylphenyl)sulfonyl-N-[4-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]iminocyclohexa-2,5-dien-1-ylidene]benzenecarboximidamide (PubChem CID 75408906) has the molecular formula C34H28N4O4S2 and a molecular weight of 620.76 g/mol. Its IUPAC name is N'-(4-methylphenyl)sulfonyl-N-[4-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]iminocyclohexa-2,5-dien-1-ylidene]benzenecarboximidamide.
| Compound Name | N'-(4-methylphenyl)sulfonyl-N-[4-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]iminocyclohexa-2,5-dien-1-ylidene]benzenecarboximidamide |
|---|---|
| PubChem CID | 75408906 |
| Molecular Formula | C34H28N4O4S2 |
| Molecular Weight | 620.76 g/mol |
| Exact Mass | 620.16 |
| IUPAC Name | N'-(4-methylphenyl)sulfonyl-N-[4-[(E)-N-(4-methylphenyl)sulfonyl-C-phenylcarbonimidoyl]iminocyclohexa-2,5-dien-1-ylidene]benzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(/N=C2C=CC(=N/C(=N/S(=O)(=O)c3ccc(C)cc3)c3ccccc3)C=C2)c2ccccc2)cc1 |
| InChI | InChI=1S/C34H28N4O4S2/c1-25-13-21-31(22-14-25)43(39,40)37-33(27-9-5-3-6-10-27)35-29-17-19-30(20-18-29)36-34(28-11-7-4-8-12-28)38-44(41,42)32-23-15-26(2)16-24-32/h3-24H,1-2H3/b35-29-,36-30+,37-33+,38-34+ |
| InChIKey | YDFMYUFOICJSPB-UAOKTBNWSA-N |
| XLogP | 6.28 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.76 |
| LogP ≤ 5 | 6.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|