C19H13BrN2O3S — CID 6753166
N'-(benzenesulfonyl)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide (PubChem CID 6753166) has the molecular formula C19H13BrN2O3S and a molecular weight of 429.30 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide |
|---|---|
| PubChem CID | 6753166 |
| Molecular Formula | C19H13BrN2O3S |
| Molecular Weight | 429.30 g/mol |
| Exact Mass | 427.98 |
| IUPAC Name | N'-(benzenesulfonyl)-N-(3-bromo-4-oxocyclohexa-2,5-dien-1-ylidene)benzenecarboximidamide |
| SMILES | O=C1C=C/C(=N\C(=N\S(=O)(=O)c2ccccc2)c2ccccc2)C=C1Br |
| InChI | InChI=1S/C19H13BrN2O3S/c20-17-13-15(11-12-18(17)23)21-19(14-7-3-1-4-8-14)22-26(24,25)16-9-5-2-6-10-16/h1-13H/b21-15+,22-19+ |
| InChIKey | DKIIFHNNVBTPLZ-YHRNEYPQSA-N |
| XLogP | 3.68 |
| TPSA | 75.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.30 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|