C19H25NO2SSi — CID 164665268
(NZ)-N-[[tert-butyl(dimethyl)silyl]-phenylmethylidene]benzenesulfonamide (PubChem CID 164665268) has the molecular formula C19H25NO2SSi and a molecular weight of 359.57 g/mol. Its IUPAC name is (NZ)-N-[[tert-butyl(dimethyl)silyl]-phenylmethylidene]benzenesulfonamide.
| Compound Name | (NZ)-N-[[tert-butyl(dimethyl)silyl]-phenylmethylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 164665268 |
| Molecular Formula | C19H25NO2SSi |
| Molecular Weight | 359.57 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (NZ)-N-[[tert-butyl(dimethyl)silyl]-phenylmethylidene]benzenesulfonamide |
| SMILES | CC(C)(C)[Si](C)(C)/C(=N\S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H25NO2SSi/c1-19(2,3)24(4,5)18(16-12-8-6-9-13-16)20-23(21,22)17-14-10-7-11-15-17/h6-15H,1-5H3/b20-18- |
| InChIKey | WLNNQIOUERMHGC-ZZEZOPTASA-N |
| XLogP | 4.91 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.57 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|