C27H24FNO2SSi — CID 164665321
(NZ)-N-[(4-fluorophenyl)-[methyl(diphenyl)silyl]methylidene]-4-methylbenzenesulfonamide (PubChem CID 164665321) has the molecular formula C27H24FNO2SSi and a molecular weight of 473.65 g/mol. Its IUPAC name is (NZ)-N-[(4-fluorophenyl)-[methyl(diphenyl)silyl]methylidene]-4-methylbenzenesulfonamide.
| Compound Name | (NZ)-N-[(4-fluorophenyl)-[methyl(diphenyl)silyl]methylidene]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 164665321 |
| Molecular Formula | C27H24FNO2SSi |
| Molecular Weight | 473.65 g/mol |
| Exact Mass | 473.13 |
| IUPAC Name | (NZ)-N-[(4-fluorophenyl)-[methyl(diphenyl)silyl]methylidene]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(/c2ccc(F)cc2)[Si](C)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C27H24FNO2SSi/c1-21-13-19-24(20-14-21)32(30,31)29-27(22-15-17-23(28)18-16-22)33(2,25-9-5-3-6-10-25)26-11-7-4-8-12-26/h3-20H,1-2H3/b29-27- |
| InChIKey | WWSMGRUHHYZKNW-OHYPFYFLSA-N |
| XLogP | 4.74 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.65 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|