C21H20N2O4S2 — CID 2873223
N'-(benzenesulfonyl)-N-methyl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 2873223) has the molecular formula C21H20N2O4S2 and a molecular weight of 428.54 g/mol. Its IUPAC name is N'-(benzenesulfonyl)-N-methyl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N'-(benzenesulfonyl)-N-methyl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 2873223 |
| Molecular Formula | C21H20N2O4S2 |
| Molecular Weight | 428.54 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N'-(benzenesulfonyl)-N-methyl-N-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N(C)C(=NS(=O)(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2O4S2/c1-17-13-15-20(16-14-17)29(26,27)23(2)21(18-9-5-3-6-10-18)22-28(24,25)19-11-7-4-8-12-19/h3-16H,1-2H3 |
| InChIKey | MUAVRJSAOCWYRE-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 83.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.54 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|