C20H19N3O4S2 — CID 11835108
N-(benzenesulfonamido)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide (PubChem CID 11835108) has the molecular formula C20H19N3O4S2 and a molecular weight of 429.52 g/mol. Its IUPAC name is N-(benzenesulfonamido)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide.
| Compound Name | N-(benzenesulfonamido)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
|---|---|
| PubChem CID | 11835108 |
| Molecular Formula | C20H19N3O4S2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | N-(benzenesulfonamido)-N'-(4-methylphenyl)sulfonylbenzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\NNS(=O)(=O)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C20H19N3O4S2/c1-16-12-14-19(15-13-16)28(24,25)22-20(17-8-4-2-5-9-17)21-23-29(26,27)18-10-6-3-7-11-18/h2-15,23H,1H3,(H,21,22) |
| InChIKey | BEMIQGXTIZXORV-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 104.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|