C21H16F3NO2S — CID 134997728
(NE)-4-methyl-N-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide (PubChem CID 134997728) has the molecular formula C21H16F3NO2S and a molecular weight of 403.43 g/mol. Its IUPAC name is (NE)-4-methyl-N-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide.
| Compound Name | (NE)-4-methyl-N-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide |
|---|---|
| PubChem CID | 134997728 |
| Molecular Formula | C21H16F3NO2S |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (NE)-4-methyl-N-[phenyl-[4-(trifluoromethyl)phenyl]methylidene]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\c2ccccc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C21H16F3NO2S/c1-15-7-13-19(14-8-15)28(26,27)25-20(16-5-3-2-4-6-16)17-9-11-18(12-10-17)21(22,23)24/h2-14H,1H3/b25-20+ |
| InChIKey | PSOGHJROKRKWCG-LKUDQCMESA-N |
| XLogP | 5.24 |
| TPSA | 46.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|