C14H11F3O2S — CID 25017943
1-methyl-4-[4-(trifluoromethyl)phenyl]sulfonylbenzene (PubChem CID 25017943) has the molecular formula C14H11F3O2S and a molecular weight of 300.30 g/mol. Its IUPAC name is 1-methyl-4-[4-(trifluoromethyl)phenyl]sulfonylbenzene.
| Compound Name | 1-methyl-4-[4-(trifluoromethyl)phenyl]sulfonylbenzene |
|---|---|
| PubChem CID | 25017943 |
| Molecular Formula | C14H11F3O2S |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.04 |
| IUPAC Name | 1-methyl-4-[4-(trifluoromethyl)phenyl]sulfonylbenzene |
| SMILES | Cc1ccc(S(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C14H11F3O2S/c1-10-2-6-12(7-3-10)20(18,19)13-8-4-11(5-9-13)14(15,16)17/h2-9H,1H3 |
| InChIKey | RFUZMQWKARVRAV-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |