C18H12F6N2O2S — CID 138377314
4-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]imidazole (PubChem CID 138377314) has the molecular formula C18H12F6N2O2S and a molecular weight of 434.36 g/mol. Its IUPAC name is 4-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]imidazole.
| Compound Name | 4-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]imidazole |
|---|---|
| PubChem CID | 138377314 |
| Molecular Formula | C18H12F6N2O2S |
| Molecular Weight | 434.36 g/mol |
| Exact Mass | 434.05 |
| IUPAC Name | 4-(4-methylphenyl)sulfonyl-5-(trifluoromethyl)-1-[4-(trifluoromethyl)phenyl]imidazole |
| SMILES | Cc1ccc(S(=O)(=O)c2ncn(-c3ccc(C(F)(F)F)cc3)c2C(F)(F)F)cc1 |
| InChI | InChI=1S/C18H12F6N2O2S/c1-11-2-8-14(9-3-11)29(27,28)16-15(18(22,23)24)26(10-25-16)13-6-4-12(5-7-13)17(19,20)21/h2-10H,1H3 |
| InChIKey | RUFZMWYRRLVOFQ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.36 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |