C19H14FN5O2S — CID 169035085
16-fluoro-9-(4-methylphenyl)sulfonyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene (PubChem CID 169035085) has the molecular formula C19H14FN5O2S and a molecular weight of 395.42 g/mol. Its IUPAC name is 16-fluoro-9-(4-methylphenyl)sulfonyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene.
| Compound Name | 16-fluoro-9-(4-methylphenyl)sulfonyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
|---|---|
| PubChem CID | 169035085 |
| Molecular Formula | C19H14FN5O2S |
| Molecular Weight | 395.42 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | 16-fluoro-9-(4-methylphenyl)sulfonyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
| SMILES | Cc1ccc(S(=O)(=O)c2ncn3c2Cc2cnnn2-c2cc(F)ccc2-3)cc1 |
| InChI | InChI=1S/C19H14FN5O2S/c1-12-2-5-15(6-3-12)28(26,27)19-18-9-14-10-22-23-25(14)17-8-13(20)4-7-16(17)24(18)11-21-19/h2-8,10-11H,9H2,1H3 |
| InChIKey | VORSOCPSQHVHOX-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.42 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |