C13H8ClN5O — CID 140879721
16-chloro-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carbaldehyde (PubChem CID 140879721) has the molecular formula C13H8ClN5O and a molecular weight of 285.69 g/mol. Its IUPAC name is 16-chloro-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carbaldehyde.
| Compound Name | 16-chloro-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carbaldehyde |
|---|---|
| PubChem CID | 140879721 |
| Molecular Formula | C13H8ClN5O |
| Molecular Weight | 285.69 g/mol |
| Exact Mass | 285.04 |
| IUPAC Name | 16-chloro-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carbaldehyde |
| SMILES | O=Cc1ncn2c1Cc1cnnn1-c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C13H8ClN5O/c14-8-1-2-11-13(3-8)19-9(5-16-17-19)4-12-10(6-20)15-7-18(11)12/h1-3,5-7H,4H2 |
| InChIKey | ZUAPXDRPHAENRB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 65.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.69 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|