C22H14F3N5 — CID 135139548
16-methyl-9-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene (PubChem CID 135139548) has the molecular formula C22H14F3N5 and a molecular weight of 405.38 g/mol. Its IUPAC name is 16-methyl-9-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene.
| Compound Name | 16-methyl-9-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
|---|---|
| PubChem CID | 135139548 |
| Molecular Formula | C22H14F3N5 |
| Molecular Weight | 405.38 g/mol |
| Exact Mass | 405.12 |
| IUPAC Name | 16-methyl-9-[2-[4-(trifluoromethyl)phenyl]ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
| SMILES | Cc1ccc2c(c1)-n1nncc1Cc1c(C#Cc3ccc(C(F)(F)F)cc3)ncn1-2 |
| InChI | InChI=1S/C22H14F3N5/c1-14-2-9-19-21(10-14)30-17(12-27-28-30)11-20-18(26-13-29(19)20)8-5-15-3-6-16(7-4-15)22(23,24)25/h2-4,6-7,9-10,12-13H,11H2,1H3 |
| InChIKey | BHZPLKAJOMRZKS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|