C21H15N5 — CID 135139545
16-methyl-9-(2-phenylethynyl)-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene (PubChem CID 135139545) has the molecular formula C21H15N5 and a molecular weight of 337.39 g/mol. Its IUPAC name is 16-methyl-9-(2-phenylethynyl)-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene.
| Compound Name | 16-methyl-9-(2-phenylethynyl)-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
|---|---|
| PubChem CID | 135139545 |
| Molecular Formula | C21H15N5 |
| Molecular Weight | 337.39 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | 16-methyl-9-(2-phenylethynyl)-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
| SMILES | Cc1ccc2c(c1)-n1nncc1Cc1c(C#Cc3ccccc3)ncn1-2 |
| InChI | InChI=1S/C21H15N5/c1-15-7-10-19-21(11-15)26-17(13-23-24-26)12-20-18(22-14-25(19)20)9-8-16-5-3-2-4-6-16/h2-7,10-11,13-14H,12H2,1H3 |
| InChIKey | JXYZDTQNEZVHLE-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 48.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.39 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|