C20H16N6O — CID 163594941
16-methoxy-9-[2-(1-methylpyrrol-2-yl)ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene (PubChem CID 163594941) has the molecular formula C20H16N6O and a molecular weight of 356.39 g/mol. Its IUPAC name is 16-methoxy-9-[2-(1-methylpyrrol-2-yl)ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene.
| Compound Name | 16-methoxy-9-[2-(1-methylpyrrol-2-yl)ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
|---|---|
| PubChem CID | 163594941 |
| Molecular Formula | C20H16N6O |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | 16-methoxy-9-[2-(1-methylpyrrol-2-yl)ethynyl]-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
| SMILES | COc1ccc2c(c1)-n1nncc1Cc1c(C#Cc3cccn3C)ncn1-2 |
| InChI | InChI=1S/C20H16N6O/c1-24-9-3-4-14(24)5-7-17-19-10-15-12-22-23-26(15)20-11-16(27-2)6-8-18(20)25(19)13-21-17/h3-4,6,8-9,11-13H,10H2,1-2H3 |
| InChIKey | GSQIGPYSODUSIW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 62.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|