C20H17N7 — CID 159514057
9-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene (PubChem CID 159514057) has the molecular formula C20H17N7 and a molecular weight of 355.41 g/mol. Its IUPAC name is 9-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene.
| Compound Name | 9-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
|---|---|
| PubChem CID | 159514057 |
| Molecular Formula | C20H17N7 |
| Molecular Weight | 355.41 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | 9-[2-(2,3-dimethylimidazol-4-yl)ethynyl]-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene |
| SMILES | Cc1ccc2c(c1)-n1nncc1Cc1c(C#Cc3cnc(C)n3C)ncn1-2 |
| InChI | InChI=1S/C20H17N7/c1-13-4-7-18-20(8-13)27-16(11-23-24-27)9-19-17(22-12-26(18)19)6-5-15-10-21-14(2)25(15)3/h4,7-8,10-12H,9H2,1-3H3 |
| InChIKey | YWHVQKJLILXYPC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 66.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.41 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|