C17H14N6O2 — CID 153126571
ethyl 9-cyano-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5-carboxylate (PubChem CID 153126571) has the molecular formula C17H14N6O2 and a molecular weight of 334.34 g/mol. Its IUPAC name is ethyl 9-cyano-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5-carboxylate.
| Compound Name | ethyl 9-cyano-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5-carboxylate |
|---|---|
| PubChem CID | 153126571 |
| Molecular Formula | C17H14N6O2 |
| Molecular Weight | 334.34 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | ethyl 9-cyano-16-methyl-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5-carboxylate |
| SMILES | CCOC(=O)c1nnn2c1Cc1c(C#N)ncn1-c1ccc(C)cc1-2 |
| InChI | InChI=1S/C17H14N6O2/c1-3-25-17(24)16-15-7-13-11(8-18)19-9-22(13)12-5-4-10(2)6-14(12)23(15)21-20-16/h4-6,9H,3,7H2,1-2H3 |
| InChIKey | VVXKCHJNUPLJEW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 98.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |