C18H15N5O3 — CID 135228241
ethyl 5-ethynyl-16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate (PubChem CID 135228241) has the molecular formula C18H15N5O3 and a molecular weight of 349.35 g/mol. Its IUPAC name is ethyl 5-ethynyl-16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate.
| Compound Name | ethyl 5-ethynyl-16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate |
|---|---|
| PubChem CID | 135228241 |
| Molecular Formula | C18H15N5O3 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.12 |
| IUPAC Name | ethyl 5-ethynyl-16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate |
| SMILES | C#Cc1nnn2c1Cc1c(C(=O)OCC)ncn1-c1ccc(OC)cc1-2 |
| InChI | InChI=1S/C18H15N5O3/c1-4-12-14-9-16-17(18(24)26-5-2)19-10-22(16)13-7-6-11(25-3)8-15(13)23(14)21-20-12/h1,6-8,10H,5,9H2,2-3H3 |
| InChIKey | IFHFWEGUVPOUMJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 84.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|