C24H21N5O5 — CID 118178263
9-O-benzyl 5-O-ethyl 16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5,9-dicarboxylate (PubChem CID 118178263) has the molecular formula C24H21N5O5 and a molecular weight of 459.46 g/mol. Its IUPAC name is 9-O-benzyl 5-O-ethyl 16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5,9-dicarboxylate.
| Compound Name | 9-O-benzyl 5-O-ethyl 16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5,9-dicarboxylate |
|---|---|
| PubChem CID | 118178263 |
| Molecular Formula | C24H21N5O5 |
| Molecular Weight | 459.46 g/mol |
| Exact Mass | 459.15 |
| IUPAC Name | 9-O-benzyl 5-O-ethyl 16-methoxy-2,3,4,10,12-pentazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-5,9-dicarboxylate |
| SMILES | CCOC(=O)c1nnn2c1Cc1c(C(=O)OCc3ccccc3)ncn1-c1ccc(OC)cc1-2 |
| InChI | InChI=1S/C24H21N5O5/c1-3-33-24(31)22-20-12-19-21(23(30)34-13-15-7-5-4-6-8-15)25-14-28(19)17-10-9-16(32-2)11-18(17)29(20)27-26-22/h4-11,14H,3,12-13H2,1-2H3 |
| InChIKey | HLVGYYNBNIYBGF-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 110.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.46 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |