C24H22N4O2 — CID 126497585
ethyl 5-benzyl-16-methyl-2,3,10,12-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate (PubChem CID 126497585) has the molecular formula C24H22N4O2 and a molecular weight of 398.47 g/mol. Its IUPAC name is ethyl 5-benzyl-16-methyl-2,3,10,12-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate.
| Compound Name | ethyl 5-benzyl-16-methyl-2,3,10,12-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate |
|---|---|
| PubChem CID | 126497585 |
| Molecular Formula | C24H22N4O2 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.17 |
| IUPAC Name | ethyl 5-benzyl-16-methyl-2,3,10,12-tetrazatetracyclo[11.4.0.02,6.08,12]heptadeca-1(13),3,5,8,10,14,16-heptaene-9-carboxylate |
| SMILES | CCOC(=O)c1ncn2c1Cc1c(Cc3ccccc3)cnn1-c1cc(C)ccc1-2 |
| InChI | InChI=1S/C24H22N4O2/c1-3-30-24(29)23-22-13-20-18(12-17-7-5-4-6-8-17)14-26-28(20)21-11-16(2)9-10-19(21)27(22)15-25-23/h4-11,14-15H,3,12-13H2,1-2H3 |
| InChIKey | KKPYHJBBWQDBSO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |